About N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide
N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide (PubChem CID 4539981) has the molecular formula C10H11N3OS2
and a molecular weight of 253.35 g/mol. Its IUPAC name is N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide.
Molecular Properties
| Compound Name | N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide |
| PubChem CID | 4539981 |
| Molecular Formula | C10H11N3OS2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide |
| SMILES | CCC(=O)NC(=S)c1c(C)nc2sccn12 |
| InChI | InChI=1S/C10H11N3OS2/c1-3-7(14)12-9(15)8-6(2)11-10-13(8)4-5-16-10/h4-5H,3H2,1-2H3,(H,12,14,15) |
| InChIKey | WDDGCXWILZQISF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide?
The IUPAC name of N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide (CID 4539981) is N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide.
What is the SMILES notation for N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide?
The canonical SMILES for N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide is CCC(=O)NC(=S)c1c(C)nc2sccn12.
What is the InChIKey of N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide?
The InChIKey is WDDGCXWILZQISF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS2/c1-3-7(14)12-9(15)8-6(2)11-10-13(8)4-5-16-10/h4-5H,3H2,1-2H3,(H,12,14,15).
What are the key properties of N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide?
N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide has a molecular weight of 253.35 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)propanamide is sourced from PubChem (CID 4539981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).