About [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol
[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol (PubChem CID 4540225) has the molecular formula C18H19N3OS
and a molecular weight of 325.44 g/mol. Its IUPAC name is [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol |
| PubChem CID | 4540225 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(c2ncnc3scc(-c4ccccc4)c23)C1 |
| InChI | InChI=1S/C18H19N3OS/c22-10-13-5-4-8-21(9-13)17-16-15(14-6-2-1-3-7-14)11-23-18(16)20-12-19-17/h1-3,6-7,11-13,22H,4-5,8-10H2 |
| InChIKey | DPNXCAIGIMLFBE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol?
The IUPAC name of [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol (CID 4540225) is [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol.
What is the SMILES notation for [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol?
The canonical SMILES for [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol is OCC1CCCN(c2ncnc3scc(-c4ccccc4)c23)C1.
What is the InChIKey of [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol?
The InChIKey is DPNXCAIGIMLFBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3OS/c22-10-13-5-4-8-21(9-13)17-16-15(14-6-2-1-3-7-14)11-23-18(16)20-12-19-17/h1-3,6-7,11-13,22H,4-5,8-10H2.
What are the key properties of [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol?
[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol has a molecular weight of 325.44 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]methanol is sourced from PubChem (CID 4540225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).