C19H22BrN3S — CID 4540507
N-[5-(4-bromophenyl)-4H-1,3,4-thiadiazin-2-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 4540507) has the molecular formula C19H22BrN3S and a molecular weight of 404.38 g/mol. Its IUPAC name is N-[5-(4-bromophenyl)-4H-1,3,4-thiadiazin-2-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | N-[5-(4-bromophenyl)-4H-1,3,4-thiadiazin-2-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 4540507 |
| Molecular Formula | C19H22BrN3S |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-[5-(4-bromophenyl)-4H-1,3,4-thiadiazin-2-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | CC12CCC(CC1=NC1=NNC(c3ccc(Br)cc3)=CS1)C2(C)C |
| InChI | InChI=1S/C19H22BrN3S/c1-18(2)13-8-9-19(18,3)16(10-13)21-17-23-22-15(11-24-17)12-4-6-14(20)7-5-12/h4-7,11,13,22H,8-10H2,1-3H3 |
| InChIKey | AYULKEVXRKHBFK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|