About 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole
1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole (PubChem CID 4540798) has the molecular formula C14H16BrN3S
and a molecular weight of 338.27 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole.
Molecular Properties
| Compound Name | 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole |
| PubChem CID | 4540798 |
| Molecular Formula | C14H16BrN3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole |
| SMILES | CSCCc1nn(-c2cccc(Br)c2)c2c1CCN2 |
| InChI | InChI=1S/C14H16BrN3S/c1-19-8-6-13-12-5-7-16-14(12)18(17-13)11-4-2-3-10(15)9-11/h2-4,9,16H,5-8H2,1H3 |
| InChIKey | MCIAHGLZJFYVSB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole?
The IUPAC name of 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole (CID 4540798) is 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole.
What is the SMILES notation for 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole?
The canonical SMILES for 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole is CSCCc1nn(-c2cccc(Br)c2)c2c1CCN2.
What is the InChIKey of 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole?
The InChIKey is MCIAHGLZJFYVSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrN3S/c1-19-8-6-13-12-5-7-16-14(12)18(17-13)11-4-2-3-10(15)9-11/h2-4,9,16H,5-8H2,1H3.
What are the key properties of 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole?
1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole has a molecular weight of 338.27 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromophenyl)-3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole is sourced from PubChem (CID 4540798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).