C23H22FN5O5 — CID 4540955
2-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-1-[3-methyl-4-(4-methyl-3-nitrobenzoyl)piperazin-1-yl]ethanone (PubChem CID 4540955) has the molecular formula C23H22FN5O5 and a molecular weight of 467.46 g/mol. Its IUPAC name is 2-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-1-[3-methyl-4-(4-methyl-3-nitrobenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-1-[3-methyl-4-(4-methyl-3-nitrobenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4540955 |
| Molecular Formula | C23H22FN5O5 |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-1-[3-methyl-4-(4-methyl-3-nitrobenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)Cc3noc(-c4cccc(F)c4)n3)CC2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H22FN5O5/c1-14-6-7-17(11-19(14)29(32)33)23(31)28-9-8-27(13-15(28)2)21(30)12-20-25-22(34-26-20)16-4-3-5-18(24)10-16/h3-7,10-11,15H,8-9,12-13H2,1-2H3 |
| InChIKey | HZVIHAQUKXLRLB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 122.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|