About [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate
[4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate (PubChem CID 4541630) has the molecular formula C28H16F2N2O5
and a molecular weight of 498.44 g/mol. Its IUPAC name is [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate.
Molecular Properties
| Compound Name | [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate |
| PubChem CID | 4541630 |
| Molecular Formula | C28H16F2N2O5 |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate |
| SMILES | O=C(Oc1ccc(-c2noc(-c3ccc(OC(=O)c4ccc(F)cc4)cc3)n2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H16F2N2O5/c29-21-9-1-19(2-10-21)27(33)35-23-13-5-17(6-14-23)25-31-26(37-32-25)18-7-15-24(16-8-18)36-28(34)20-3-11-22(30)12-4-20/h1-16H |
| InChIKey | FQDCLJUYHLLQCU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate?
The IUPAC name of [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate (CID 4541630) is [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate.
What is the SMILES notation for [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate?
The canonical SMILES for [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate is O=C(Oc1ccc(-c2noc(-c3ccc(OC(=O)c4ccc(F)cc4)cc3)n2)cc1)c1ccc(F)cc1.
What is the InChIKey of [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate?
The InChIKey is FQDCLJUYHLLQCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H16F2N2O5/c29-21-9-1-19(2-10-21)27(33)35-23-13-5-17(6-14-23)25-31-26(37-32-25)18-7-15-24(16-8-18)36-28(34)20-3-11-22(30)12-4-20/h1-16H.
What are the key properties of [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate?
[4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate has a molecular weight of 498.44 g/mol, XLogP of 6.12, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-[4-(4-fluorobenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-fluorobenzoate is sourced from PubChem (CID 4541630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).