C7H12N4OS — CID 4541789
1-(4-methylthiadiazol-5-yl)-3-propylurea (PubChem CID 4541789) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is 1-(4-methylthiadiazol-5-yl)-3-propylurea.
| Compound Name | 1-(4-methylthiadiazol-5-yl)-3-propylurea |
|---|---|
| PubChem CID | 4541789 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 1-(4-methylthiadiazol-5-yl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1snnc1C |
| InChI | InChI=1S/C7H12N4OS/c1-3-4-8-7(12)9-6-5(2)10-11-13-6/h3-4H2,1-2H3,(H2,8,9,12) |
| InChIKey | HUPIEPJFDVVALC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |