C20H18N4O6 — CID 4542105
2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 4542105) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4542105 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CN1C(=O)NC2(CCc3ccccc32)C1=O |
| InChI | InChI=1S/C20H18N4O6/c1-30-16-10-13(24(28)29)6-7-15(16)21-17(25)11-23-18(26)20(22-19(23)27)9-8-12-4-2-3-5-14(12)20/h2-7,10H,8-9,11H2,1H3,(H,21,25)(H,22,27) |
| InChIKey | YWEUWNWWOCKLGD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|