C19H11Cl2N3O2 — CID 4543058
3,4-dichloro-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide (PubChem CID 4543058) has the molecular formula C19H11Cl2N3O2 and a molecular weight of 384.22 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 4543058 |
| Molecular Formula | C19H11Cl2N3O2 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 3,4-dichloro-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nc3ncccc3o2)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H11Cl2N3O2/c20-14-7-6-11(10-15(14)21)18(25)23-13-4-1-3-12(9-13)19-24-17-16(26-19)5-2-8-22-17/h1-10H,(H,23,25) |
| InChIKey | CMAWPVCYVXZOND-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |