C20H19NO5 — CID 45433235
1-(1,3-benzodioxole-5-carbonyl)-4-phenylpiperidine-4-carboxylic acid (PubChem CID 45433235) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxole-5-carbonyl)-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-(1,3-benzodioxole-5-carbonyl)-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45433235 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-(1,3-benzodioxole-5-carbonyl)-4-phenylpiperidine-4-carboxylic acid |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCC(C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H19NO5/c22-18(14-6-7-16-17(12-14)26-13-25-16)21-10-8-20(9-11-21,19(23)24)15-4-2-1-3-5-15/h1-7,12H,8-11,13H2,(H,23,24) |
| InChIKey | SBZZYYVKJNTHCF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |