About 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid
1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid (PubChem CID 45433563) has the molecular formula C24H25NO4
and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid |
| PubChem CID | 45433563 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid |
| SMILES | Cc1ccc2c(CC(=O)N3CCC(C(=O)O)(c4ccccc4)CC3)coc2c1C |
| InChI | InChI=1S/C24H25NO4/c1-16-8-9-20-18(15-29-22(20)17(16)2)14-21(26)25-12-10-24(11-13-25,23(27)28)19-6-4-3-5-7-19/h3-9,15H,10-14H2,1-2H3,(H,27,28) |
| InChIKey | RGHNTXFVMYOLNQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid?
The IUPAC name of 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid (CID 45433563) is 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid.
What is the SMILES notation for 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid?
The canonical SMILES for 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid is Cc1ccc2c(CC(=O)N3CCC(C(=O)O)(c4ccccc4)CC3)coc2c1C.
What is the InChIKey of 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid?
The InChIKey is RGHNTXFVMYOLNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO4/c1-16-8-9-20-18(15-29-22(20)17(16)2)14-21(26)25-12-10-24(11-13-25,23(27)28)19-6-4-3-5-7-19/h3-9,15H,10-14H2,1-2H3,(H,27,28).
What are the key properties of 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid?
1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid has a molecular weight of 391.47 g/mol, XLogP of 4.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(6,7-dimethyl-1-benzofuran-3-yl)acetyl]-4-phenylpiperidine-4-carboxylic acid is sourced from PubChem (CID 45433563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).