C21H25NO3S — CID 45433624
1-(5-methyl-4-propylthiophene-2-carbonyl)-4-phenylpiperidine-4-carboxylic acid (PubChem CID 45433624) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 1-(5-methyl-4-propylthiophene-2-carbonyl)-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-(5-methyl-4-propylthiophene-2-carbonyl)-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45433624 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-(5-methyl-4-propylthiophene-2-carbonyl)-4-phenylpiperidine-4-carboxylic acid |
| SMILES | CCCc1cc(C(=O)N2CCC(C(=O)O)(c3ccccc3)CC2)sc1C |
| InChI | InChI=1S/C21H25NO3S/c1-3-7-16-14-18(26-15(16)2)19(23)22-12-10-21(11-13-22,20(24)25)17-8-5-4-6-9-17/h4-6,8-9,14H,3,7,10-13H2,1-2H3,(H,24,25) |
| InChIKey | SSMRIKQWZNUTAT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |