C16H9BrCl2N2 — CID 4543496
5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile (PubChem CID 4543496) has the molecular formula C16H9BrCl2N2 and a molecular weight of 380.07 g/mol. Its IUPAC name is 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile.
| Compound Name | 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile |
|---|---|
| PubChem CID | 4543496 |
| Molecular Formula | C16H9BrCl2N2 |
| Molecular Weight | 380.07 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile |
| SMILES | N#Cc1cn(Cc2ccc(Cl)c(Cl)c2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C16H9BrCl2N2/c17-12-2-4-16-13(6-12)11(7-20)9-21(16)8-10-1-3-14(18)15(19)5-10/h1-6,9H,8H2 |
| InChIKey | VTCKWKWARUCALD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.07 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |