About 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile
5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile (PubChem CID 4543496) has the molecular formula C16H9BrCl2N2
and a molecular weight of 380.07 g/mol. Its IUPAC name is 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile |
| PubChem CID | 4543496 |
| Molecular Formula | C16H9BrCl2N2 |
| Molecular Weight | 380.07 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile |
| SMILES | N#Cc1cn(Cc2ccc(Cl)c(Cl)c2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C16H9BrCl2N2/c17-12-2-4-16-13(6-12)11(7-20)9-21(16)8-10-1-3-14(18)15(19)5-10/h1-6,9H,8H2 |
| InChIKey | VTCKWKWARUCALD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.07 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile?
The IUPAC name of 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile (CID 4543496) is 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile.
What is the SMILES notation for 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile?
The canonical SMILES for 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile is N#Cc1cn(Cc2ccc(Cl)c(Cl)c2)c2ccc(Br)cc12.
What is the InChIKey of 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile?
The InChIKey is VTCKWKWARUCALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9BrCl2N2/c17-12-2-4-16-13(6-12)11(7-20)9-21(16)8-10-1-3-14(18)15(19)5-10/h1-6,9H,8H2.
What are the key properties of 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile?
5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile has a molecular weight of 380.07 g/mol, XLogP of 5.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-[(3,4-dichlorophenyl)methyl]indole-3-carbonitrile is sourced from PubChem (CID 4543496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).