C16H14ClNO5 — CID 45436153
4-chloro-2-[(2,4-dimethoxybenzoyl)amino]benzoic acid (PubChem CID 45436153) has the molecular formula C16H14ClNO5 and a molecular weight of 335.74 g/mol. Its IUPAC name is 4-chloro-2-[(2,4-dimethoxybenzoyl)amino]benzoic acid.
| Compound Name | 4-chloro-2-[(2,4-dimethoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 45436153 |
| Molecular Formula | C16H14ClNO5 |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4-chloro-2-[(2,4-dimethoxybenzoyl)amino]benzoic acid |
| SMILES | COc1ccc(C(=O)Nc2cc(Cl)ccc2C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C16H14ClNO5/c1-22-10-4-6-12(14(8-10)23-2)15(19)18-13-7-9(17)3-5-11(13)16(20)21/h3-8H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | PTXUAKNDJMHAHU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |