C18H19NO6S — CID 45436828
3-(4-methoxyphenyl)-3-[(4-methylsulfonylbenzoyl)amino]propanoic acid (PubChem CID 45436828) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-3-[(4-methylsulfonylbenzoyl)amino]propanoic acid.
| Compound Name | 3-(4-methoxyphenyl)-3-[(4-methylsulfonylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 45436828 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-3-[(4-methylsulfonylbenzoyl)amino]propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)NC(=O)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H19NO6S/c1-25-14-7-3-12(4-8-14)16(11-17(20)21)19-18(22)13-5-9-15(10-6-13)26(2,23)24/h3-10,16H,11H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | IRIHGAXXYGBARL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |