C17H16N4 — CID 4544384
10,10-dimethyltricyclo[7.1.1.02,7]undec-2-ene-5,5,6,6-tetracarbonitrile (PubChem CID 4544384) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 10,10-dimethyltricyclo[7.1.1.02,7]undec-2-ene-5,5,6,6-tetracarbonitrile.
| Compound Name | 10,10-dimethyltricyclo[7.1.1.02,7]undec-2-ene-5,5,6,6-tetracarbonitrile |
|---|---|
| PubChem CID | 4544384 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 10,10-dimethyltricyclo[7.1.1.02,7]undec-2-ene-5,5,6,6-tetracarbonitrile |
| SMILES | CC1(C)C2CC1C1=CCC(C#N)(C#N)C(C#N)(C#N)C1C2 |
| InChI | InChI=1S/C17H16N4/c1-15(2)11-5-13(15)12-3-4-16(7-18,8-19)17(9-20,10-21)14(12)6-11/h3,11,13-14H,4-6H2,1-2H3 |
| InChIKey | XUDZQZTUNWXWFY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|