C41H35ClFN3O5 — CID 4547036
2-benzyl-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4547036) has the molecular formula C41H35ClFN3O5 and a molecular weight of 704.20 g/mol. Its IUPAC name is 2-benzyl-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-benzyl-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4547036 |
| Molecular Formula | C41H35ClFN3O5 |
| Molecular Weight | 704.20 g/mol |
| Exact Mass | 703.22 |
| IUPAC Name | 2-benzyl-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cc(C2C3=CCC4C(=O)N(Cc5ccccc5)C(=O)C4C3CC3C(=O)N(Nc4ccc(F)cc4)C(=O)C32c2ccc(Cl)cc2)cc(C)c1O |
| InChI | InChI=1S/C41H35ClFN3O5/c1-22-18-25(19-23(2)36(22)47)35-30-16-17-31-34(39(50)45(37(31)48)21-24-6-4-3-5-7-24)32(30)20-33-38(49)46(44-29-14-12-28(43)13-15-29)40(51)41(33,35)26-8-10-27(42)11-9-26/h3-16,18-19,31-35,44,47H,17,20-21H2,1-2H3 |
| InChIKey | XGHDLTAULNFRGO-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.20 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|