C21H22N4O5S — CID 45472779
4-methoxy-3-[[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]sulfamoyl]benzoic acid (PubChem CID 45472779) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 4-methoxy-3-[[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-methoxy-3-[[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 45472779 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 4-methoxy-3-[[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]sulfamoyl]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cccc(-c2nnc3n2CCCCC3)c1 |
| InChI | InChI=1S/C21H22N4O5S/c1-30-17-10-9-15(21(26)27)13-18(17)31(28,29)24-16-7-5-6-14(12-16)20-23-22-19-8-3-2-4-11-25(19)20/h5-7,9-10,12-13,24H,2-4,8,11H2,1H3,(H,26,27) |
| InChIKey | APOKTUSTZWNYAZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |