C16H15Cl2NO — CID 4547297
2,6-dichloro-N-(2-propan-2-ylphenyl)benzamide (PubChem CID 4547297) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is 2,6-dichloro-N-(2-propan-2-ylphenyl)benzamide.
| Compound Name | 2,6-dichloro-N-(2-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 4547297 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2,6-dichloro-N-(2-propan-2-ylphenyl)benzamide |
| SMILES | CC(C)c1ccccc1NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H15Cl2NO/c1-10(2)11-6-3-4-9-14(11)19-16(20)15-12(17)7-5-8-13(15)18/h3-10H,1-2H3,(H,19,20) |
| InChIKey | DQRJOWAPJZHMTD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |