About 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid
2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid (PubChem CID 4547715) has the molecular formula C12H19NO5S
and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid |
| PubChem CID | 4547715 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)NCC(=O)O)C(=O)C2 |
| InChI | InChI=1S/C12H19NO5S/c1-11(2)8-3-4-12(11,9(14)5-8)7-19(17,18)13-6-10(15)16/h8,13H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | JNKOVTPLRDNBMZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid?
The IUPAC name of 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid (CID 4547715) is 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid.
What is the SMILES notation for 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid?
The canonical SMILES for 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid is CC1(C)C2CCC1(CS(=O)(=O)NCC(=O)O)C(=O)C2.
What is the InChIKey of 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid?
The InChIKey is JNKOVTPLRDNBMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO5S/c1-11(2)8-3-4-12(11,9(14)5-8)7-19(17,18)13-6-10(15)16/h8,13H,3-7H2,1-2H3,(H,15,16).
What are the key properties of 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid?
2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid has a molecular weight of 289.35 g/mol, XLogP of 0.39, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]acetic acid is sourced from PubChem (CID 4547715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).