C12H14N3O2S- — CID 4547744
4-(diethylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 4547744) has the molecular formula C12H14N3O2S- and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-(diethylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 4-(diethylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4547744 |
| Molecular Formula | C12H14N3O2S- |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-(diethylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCN(CC)c1ncnc2sc(C(=O)[O-])c(C)c12 |
| InChI | InChI=1S/C12H15N3O2S/c1-4-15(5-2)10-8-7(3)9(12(16)17)18-11(8)14-6-13-10/h6H,4-5H2,1-3H3,(H,16,17)/p-1 |
| InChIKey | UCGONRVSATZMMN-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |