C25H41O7P2-3 — CID 45479572
[oxido-[(2Z,6Z,10Z,14E)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]phosphoryl] phosphate (PubChem CID 45479572) has the molecular formula C25H41O7P2-3 and a molecular weight of 515.54 g/mol. Its IUPAC name is [oxido-[(2Z,6Z,10Z,14E)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]phosphoryl] phosphate.
| Compound Name | [oxido-[(2Z,6Z,10Z,14E)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]phosphoryl] phosphate |
|---|---|
| PubChem CID | 45479572 |
| Molecular Formula | C25H41O7P2-3 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | [oxido-[(2Z,6Z,10Z,14E)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]phosphoryl] phosphate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C25H44O7P2/c1-21(2)11-7-12-22(3)13-8-14-23(4)15-9-16-24(5)17-10-18-25(6)19-20-31-34(29,30)32-33(26,27)28/h11,13,15,17,19H,7-10,12,14,16,18,20H2,1-6H3,(H,29,30)(H2,26,27,28)/p-3/b22-13+,23-15-,24-17-,25-19- |
| InChIKey | JMVSBFJBMXQNJW-FZKBJVPYSA-K |
| XLogP | 6.19 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|