C19H21BrN2O5 — CID 45479854
ethyl (1R,10R,11S,12R)-4-bromo-12,14-dimethyl-13,16-dioxo-8-oxa-14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5-triene-11-carboxylate (PubChem CID 45479854) has the molecular formula C19H21BrN2O5 and a molecular weight of 437.29 g/mol. Its IUPAC name is ethyl (1R,10R,11S,12R)-4-bromo-12,14-dimethyl-13,16-dioxo-8-oxa-14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5-triene-11-carboxylate.
| Compound Name | ethyl (1R,10R,11S,12R)-4-bromo-12,14-dimethyl-13,16-dioxo-8-oxa-14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5-triene-11-carboxylate |
|---|---|
| PubChem CID | 45479854 |
| Molecular Formula | C19H21BrN2O5 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | ethyl (1R,10R,11S,12R)-4-bromo-12,14-dimethyl-13,16-dioxo-8-oxa-14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5-triene-11-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2COc3ccc(Br)cc3[C@@H]2N2C(=O)CN(C)C(=O)[C@@]12C |
| InChI | InChI=1S/C19H21BrN2O5/c1-4-26-17(24)15-12-9-27-13-6-5-10(20)7-11(13)16(12)22-14(23)8-21(3)18(25)19(15,22)2/h5-7,12,15-16H,4,8-9H2,1-3H3/t12-,15-,16+,19-/m1/s1 |
| InChIKey | HVYSPNPOYLKEEZ-ZSKVKKPNSA-N |
| XLogP | 1.75 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |