C17H11F4N3O3 — CID 45480019
1-(4-hydroxyphenyl)-2-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]triazol-1-yl]ethanone (PubChem CID 45480019) has the molecular formula C17H11F4N3O3 and a molecular weight of 381.29 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-2-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]triazol-1-yl]ethanone.
| Compound Name | 1-(4-hydroxyphenyl)-2-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]triazol-1-yl]ethanone |
|---|---|
| PubChem CID | 45480019 |
| Molecular Formula | C17H11F4N3O3 |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-(4-hydroxyphenyl)-2-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]triazol-1-yl]ethanone |
| SMILES | O=C(Cn1cc(COc2c(F)c(F)cc(F)c2F)nn1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H11F4N3O3/c18-12-5-13(19)16(21)17(15(12)20)27-8-10-6-24(23-22-10)7-14(26)9-1-3-11(25)4-2-9/h1-6,25H,7-8H2 |
| InChIKey | DIVDMJJPORWFHI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|