About 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone
2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone (PubChem CID 45480025) has the molecular formula C21H21N3O4
and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone.
Molecular Properties
| Compound Name | 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone |
| PubChem CID | 45480025 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone |
| SMILES | CC(=O)c1cc(C)c(OCc2cn(CC(=O)c3ccc(O)cc3)nn2)c(C)c1 |
| InChI | InChI=1S/C21H21N3O4/c1-13-8-17(15(3)25)9-14(2)21(13)28-12-18-10-24(23-22-18)11-20(27)16-4-6-19(26)7-5-16/h4-10,26H,11-12H2,1-3H3 |
| InChIKey | PVWZZDMSTZDYTL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone?
The IUPAC name of 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone (CID 45480025) is 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone.
What is the SMILES notation for 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone?
The canonical SMILES for 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone is CC(=O)c1cc(C)c(OCc2cn(CC(=O)c3ccc(O)cc3)nn2)c(C)c1.
What is the InChIKey of 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone?
The InChIKey is PVWZZDMSTZDYTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O4/c1-13-8-17(15(3)25)9-14(2)21(13)28-12-18-10-24(23-22-18)11-20(27)16-4-6-19(26)7-5-16/h4-10,26H,11-12H2,1-3H3.
What are the key properties of 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone?
2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone has a molecular weight of 379.42 g/mol, XLogP of 3.27, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-acetyl-2,6-dimethylphenoxy)methyl]triazol-1-yl]-1-(4-hydroxyphenyl)ethanone is sourced from PubChem (CID 45480025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).