About 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium
6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium (PubChem CID 45480172) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium.
Molecular Properties
| Compound Name | 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium |
| PubChem CID | 45480172 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium |
| SMILES | Cc1cc(C2CCCCC2)n([O-])c(=O)c1.[NH3+]CCO |
| InChI | InChI=1S/C12H16NO2.C2H7NO/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;3-1-2-4/h7-8,10H,2-6H2,1H3;4H,1-3H2/q-1;/p+1 |
| InChIKey | HKUKJIQHPXYJTP-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium?
The IUPAC name of 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium (CID 45480172) is 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium.
What is the SMILES notation for 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium?
The canonical SMILES for 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium is Cc1cc(C2CCCCC2)n([O-])c(=O)c1.[NH3+]CCO.
What is the InChIKey of 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium?
The InChIKey is HKUKJIQHPXYJTP-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H16NO2.C2H7NO/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;3-1-2-4/h7-8,10H,2-6H2,1H3;4H,1-3H2/q-1;/p+1.
What are the key properties of 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium?
6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium has a molecular weight of 268.36 g/mol, XLogP of 0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;2-hydroxyethylazanium is sourced from PubChem (CID 45480172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).