C9H9N3O4 — CID 45480401
2,2-dimethyl-6-nitro-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 45480401) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is 2,2-dimethyl-6-nitro-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 2,2-dimethyl-6-nitro-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 45480401 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2,2-dimethyl-6-nitro-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])nc2NC1=O |
| InChI | InChI=1S/C9H9N3O4/c1-9(2)8(13)11-7-5(16-9)3-4-6(10-7)12(14)15/h3-4H,1-2H3,(H,10,11,13) |
| InChIKey | QPNDHHGIJAMRMD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|