About 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile
5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile (PubChem CID 45480447) has the molecular formula C7H2Cl2N4
and a molecular weight of 213.03 g/mol. Its IUPAC name is 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile.
Molecular Properties
| Compound Name | 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| PubChem CID | 45480447 |
| Molecular Formula | C7H2Cl2N4 |
| Molecular Weight | 213.03 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| SMILES | N#Cc1cnn2c(Cl)cc(Cl)nc12 |
| InChI | InChI=1S/C7H2Cl2N4/c8-5-1-6(9)13-7(12-5)4(2-10)3-11-13/h1,3H |
| InChIKey | KDFQVEDUSUYBCO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.03 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile?
The IUPAC name of 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile (CID 45480447) is 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile.
What is the SMILES notation for 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile?
The canonical SMILES for 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile is N#Cc1cnn2c(Cl)cc(Cl)nc12.
What is the InChIKey of 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile?
The InChIKey is KDFQVEDUSUYBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl2N4/c8-5-1-6(9)13-7(12-5)4(2-10)3-11-13/h1,3H.
What are the key properties of 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile?
5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile has a molecular weight of 213.03 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carbonitrile is sourced from PubChem (CID 45480447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).