About 4-chloroimidazo[5,1-f][1,2,4]triazine
4-chloroimidazo[5,1-f][1,2,4]triazine (PubChem CID 45480448) has the molecular formula C5H3ClN4
and a molecular weight of 154.56 g/mol. Its IUPAC name is 4-chloroimidazo[5,1-f][1,2,4]triazine.
Molecular Properties
| Compound Name | 4-chloroimidazo[5,1-f][1,2,4]triazine |
| PubChem CID | 45480448 |
| Molecular Formula | C5H3ClN4 |
| Molecular Weight | 154.56 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | 4-chloroimidazo[5,1-f][1,2,4]triazine |
| SMILES | Clc1ncnn2cncc12 |
| InChI | InChI=1S/C5H3ClN4/c6-5-4-1-7-3-10(4)9-2-8-5/h1-3H |
| InChIKey | YQKLYTZVBRYCJW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.56 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloroimidazo[5,1-f][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloroimidazo[5,1-f][1,2,4]triazine?
The IUPAC name of 4-chloroimidazo[5,1-f][1,2,4]triazine (CID 45480448) is 4-chloroimidazo[5,1-f][1,2,4]triazine.
What is the SMILES notation for 4-chloroimidazo[5,1-f][1,2,4]triazine?
The canonical SMILES for 4-chloroimidazo[5,1-f][1,2,4]triazine is Clc1ncnn2cncc12.
What is the InChIKey of 4-chloroimidazo[5,1-f][1,2,4]triazine?
The InChIKey is YQKLYTZVBRYCJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN4/c6-5-4-1-7-3-10(4)9-2-8-5/h1-3H.
What are the key properties of 4-chloroimidazo[5,1-f][1,2,4]triazine?
4-chloroimidazo[5,1-f][1,2,4]triazine has a molecular weight of 154.56 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloroimidazo[5,1-f][1,2,4]triazine is sourced from PubChem (CID 45480448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).