About CID 45480495
CID 45480495 (PubChem CID 45480495) has the molecular formula C5H5NNaO2S
and a molecular weight of 166.16 g/mol.
Molecular Properties
| Compound Name | CID 45480495 |
| PubChem CID | 45480495 |
| Molecular Formula | C5H5NNaO2S |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 165.99 |
| IUPAC Name | — |
| SMILES | Cc1cnc(C(=O)O)s1.[Na] |
| InChI | InChI=1S/C5H5NO2S.Na/c1-3-2-6-4(9-3)5(7)8;/h2H,1H3,(H,7,8); |
| InChIKey | DUODUJHXTFMGTC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 45480495 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 45480495?
The IUPAC name of CID 45480495 (CID 45480495) is not available.
What is the SMILES notation for CID 45480495?
The canonical SMILES for CID 45480495 is Cc1cnc(C(=O)O)s1.[Na].
What is the InChIKey of CID 45480495?
The InChIKey is DUODUJHXTFMGTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2S.Na/c1-3-2-6-4(9-3)5(7)8;/h2H,1H3,(H,7,8);.
What are the key properties of CID 45480495?
CID 45480495 has a molecular weight of 166.16 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 45480495 is sourced from PubChem (CID 45480495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).