About [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate
[3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate (PubChem CID 45480720) has the molecular formula C34H38O6S3
and a molecular weight of 638.87 g/mol. Its IUPAC name is [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate.
Molecular Properties
| Compound Name | [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate |
| PubChem CID | 45480720 |
| Molecular Formula | C34H38O6S3 |
| Molecular Weight | 638.87 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate |
| SMILES | CC(C)(C)SC1SC(SC(C)(C)C)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H38O6S3/c1-33(2,3)42-31-26(39-29(36)23-18-12-8-13-19-23)25(38-28(35)22-16-10-7-11-17-22)27(32(41-31)43-34(4,5)6)40-30(37)24-20-14-9-15-21-24/h7-21,25-27,31-32H,1-6H3 |
| InChIKey | BFQBOAFRFJDINI-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 638.87 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate?
The IUPAC name of [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate (CID 45480720) is [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate.
What is the SMILES notation for [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate?
The canonical SMILES for [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate is CC(C)(C)SC1SC(SC(C)(C)C)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1.
What is the InChIKey of [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate?
The InChIKey is BFQBOAFRFJDINI-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H38O6S3/c1-33(2,3)42-31-26(39-29(36)23-18-12-8-13-19-23)25(38-28(35)22-16-10-7-11-17-22)27(32(41-31)43-34(4,5)6)40-30(37)24-20-14-9-15-21-24/h7-21,25-27,31-32H,1-6H3.
What are the key properties of [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate?
[3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate has a molecular weight of 638.87 g/mol, XLogP of 8.13, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate is sourced from PubChem (CID 45480720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).