C28H38N2O — CID 45480884
3-methyl-5-phenyl-8-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-ol (PubChem CID 45480884) has the molecular formula C28H38N2O and a molecular weight of 418.63 g/mol. Its IUPAC name is 3-methyl-5-phenyl-8-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-ol.
| Compound Name | 3-methyl-5-phenyl-8-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
|---|---|
| PubChem CID | 45480884 |
| Molecular Formula | C28H38N2O |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | 3-methyl-5-phenyl-8-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
| SMILES | CN1CCc2cc(CN3CC4(C)CC3CC(C)(C)C4)c(O)cc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C28H38N2O/c1-27(2)14-23-15-28(3,18-27)19-30(23)16-22-12-21-10-11-29(4)17-25(24(21)13-26(22)31)20-8-6-5-7-9-20/h5-9,12-13,23,25,31H,10-11,14-19H2,1-4H3 |
| InChIKey | IYQILANVZYXSBD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|