C41H43N3O3S — CID 45481150
(E)-3-(3-cyanophenyl)-N-[4-[2-(7-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]-2-(4-phenylphenyl)prop-2-enamide (PubChem CID 45481150) has the molecular formula C41H43N3O3S and a molecular weight of 657.88 g/mol. Its IUPAC name is (E)-3-(3-cyanophenyl)-N-[4-[2-(7-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]-2-(4-phenylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-cyanophenyl)-N-[4-[2-(7-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]-2-(4-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 45481150 |
| Molecular Formula | C41H43N3O3S |
| Molecular Weight | 657.88 g/mol |
| Exact Mass | 657.30 |
| IUPAC Name | (E)-3-(3-cyanophenyl)-N-[4-[2-(7-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]-2-(4-phenylphenyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCN(CCC1CCC(NC(=O)/C(=C/c3cccc(C#N)c3)c3ccc(-c4ccccc4)cc3)CC1)CC2 |
| InChI | InChI=1S/C41H43N3O3S/c1-48(46,47)39-19-16-35-21-24-44(25-22-37(35)28-39)23-20-30-10-17-38(18-11-30)43-41(45)40(27-31-6-5-7-32(26-31)29-42)36-14-12-34(13-15-36)33-8-3-2-4-9-33/h2-9,12-16,19,26-28,30,38H,10-11,17-18,20-25H2,1H3,(H,43,45)/b40-27+ |
| InChIKey | REEHVCPDJGTBRM-WOQJSSNBSA-N |
| XLogP | 7.34 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.88 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|