About 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide
2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide (PubChem CID 45481190) has the molecular formula C20H23BrN2OS
and a molecular weight of 419.39 g/mol. Its IUPAC name is 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide.
Molecular Properties
| Compound Name | 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide |
| PubChem CID | 45481190 |
| Molecular Formula | C20H23BrN2OS |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide |
| SMILES | Br.CC(=O)CSC(/C=C/c1ccc(N(C)C)cc1)=N\c1ccccc1 |
| InChI | InChI=1S/C20H22N2OS.BrH/c1-16(23)15-24-20(21-18-7-5-4-6-8-18)14-11-17-9-12-19(13-10-17)22(2)3;/h4-14H,15H2,1-3H3;1H/b14-11+,21-20-; |
| InChIKey | SIPMBHAFXHPRQY-RFDCZNHNSA-N |
| XLogP | 5.40 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide?
The IUPAC name of 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide (CID 45481190) is 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide.
What is the SMILES notation for 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide?
The canonical SMILES for 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide is Br.CC(=O)CSC(/C=C/c1ccc(N(C)C)cc1)=N\c1ccccc1.
What is the InChIKey of 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide?
The InChIKey is SIPMBHAFXHPRQY-RFDCZNHNSA-N. The full InChI is InChI=1S/C20H22N2OS.BrH/c1-16(23)15-24-20(21-18-7-5-4-6-8-18)14-11-17-9-12-19(13-10-17)22(2)3;/h4-14H,15H2,1-3H3;1H/b14-11+,21-20-;.
What are the key properties of 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide?
2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide has a molecular weight of 419.39 g/mol, XLogP of 5.40, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl (E)-3-[4-(dimethylamino)phenyl]-N-phenylprop-2-enimidothioate;hydrobromide is sourced from PubChem (CID 45481190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).