C18H16ClN3 — CID 45481194
N-[(E)-(4-chlorophenyl)methylideneamino]-2,8-dimethylquinolin-4-amine (PubChem CID 45481194) has the molecular formula C18H16ClN3 and a molecular weight of 309.80 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-2,8-dimethylquinolin-4-amine.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2,8-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 45481194 |
| Molecular Formula | C18H16ClN3 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2,8-dimethylquinolin-4-amine |
| SMILES | Cc1cc(N/N=C/c2ccc(Cl)cc2)c2cccc(C)c2n1 |
| InChI | InChI=1S/C18H16ClN3/c1-12-4-3-5-16-17(10-13(2)21-18(12)16)22-20-11-14-6-8-15(19)9-7-14/h3-11H,1-2H3,(H,21,22)/b20-11+ |
| InChIKey | TVWWIDHKBMYHDW-RGVLZGJSSA-N |
| XLogP | 4.95 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|