C28H36Cl2N4O2 — CID 45481513
2-(3,4-dichlorophenyl)-N-[5-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]pentyl]cyclopropane-1-carboxamide (PubChem CID 45481513) has the molecular formula C28H36Cl2N4O2 and a molecular weight of 531.53 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[5-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]pentyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[5-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]pentyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 45481513 |
| Molecular Formula | C28H36Cl2N4O2 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[5-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]pentyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)NC2CCN(CCCCCNC(=O)C3CC3c3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C28H36Cl2N4O2/c1-19-5-8-21(9-6-19)32-28(36)33-22-11-15-34(16-12-22)14-4-2-3-13-31-27(35)24-18-23(24)20-7-10-25(29)26(30)17-20/h5-10,17,22-24H,2-4,11-16,18H2,1H3,(H,31,35)(H2,32,33,36) |
| InChIKey | UNVIGTWXEAABJG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|