About N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide
N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide (PubChem CID 45481554) has the molecular formula C22H15ClN2O5
and a molecular weight of 422.82 g/mol. Its IUPAC name is N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide.
Molecular Properties
| Compound Name | N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide |
| PubChem CID | 45481554 |
| Molecular Formula | C22H15ClN2O5 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide |
| SMILES | NC(=O)CCC(=O)Nc1cccc2c1C(=O)C(=O)c1c(-c3ccc(Cl)cc3)coc1-2 |
| InChI | InChI=1S/C22H15ClN2O5/c23-12-6-4-11(5-7-12)14-10-30-22-13-2-1-3-15(25-17(27)9-8-16(24)26)18(13)20(28)21(29)19(14)22/h1-7,10H,8-9H2,(H2,24,26)(H,25,27) |
| InChIKey | RRZCTGUTMVXHFF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide?
The IUPAC name of N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide (CID 45481554) is N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide.
What is the SMILES notation for N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide?
The canonical SMILES for N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide is NC(=O)CCC(=O)Nc1cccc2c1C(=O)C(=O)c1c(-c3ccc(Cl)cc3)coc1-2.
What is the InChIKey of N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide?
The InChIKey is RRZCTGUTMVXHFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClN2O5/c23-12-6-4-11(5-7-12)14-10-30-22-13-2-1-3-15(25-17(27)9-8-16(24)26)18(13)20(28)21(29)19(14)22/h1-7,10H,8-9H2,(H2,24,26)(H,25,27).
What are the key properties of N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide?
N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide has a molecular weight of 422.82 g/mol, XLogP of 3.85, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(4-chlorophenyl)-4,5-dioxobenzo[g][1]benzofuran-6-yl]butanediamide is sourced from PubChem (CID 45481554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).