C25H19N7O2 — CID 45481750
N-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2,2-diphenylacetamide (PubChem CID 45481750) has the molecular formula C25H19N7O2 and a molecular weight of 449.47 g/mol. Its IUPAC name is N-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2,2-diphenylacetamide.
| Compound Name | N-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 45481750 |
| Molecular Formula | C25H19N7O2 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2,2-diphenylacetamide |
| SMILES | Cn1cc2c(nc(NC(=O)C(c3ccccc3)c3ccccc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C25H19N7O2/c1-31-15-18-21(29-31)27-25(32-23(18)26-22(30-32)19-13-8-14-34-19)28-24(33)20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-15,20H,1H3,(H,27,28,29,33) |
| InChIKey | ZIPKODOOTJSIEO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |