C24H19N7O2S — CID 45481764
N-[4-(furan-2-yl)-11-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-3-ylacetamide (PubChem CID 45481764) has the molecular formula C24H19N7O2S and a molecular weight of 469.53 g/mol. Its IUPAC name is N-[4-(furan-2-yl)-11-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[4-(furan-2-yl)-11-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 45481764 |
| Molecular Formula | C24H19N7O2S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-[4-(furan-2-yl)-11-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)Nc1nc2nn(CCc3ccccc3)cc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C24H19N7O2S/c32-20(13-17-9-12-34-15-17)25-24-27-21-18(14-30(28-21)10-8-16-5-2-1-3-6-16)23-26-22(29-31(23)24)19-7-4-11-33-19/h1-7,9,11-12,14-15H,8,10,13H2,(H,25,27,28,32) |
| InChIKey | LRHLBUAJTSIOMS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |