C23H15Cl4NO3 — CID 45481822
4,5,6,7-tetrachloro-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]isoindole-1,3-dione (PubChem CID 45481822) has the molecular formula C23H15Cl4NO3 and a molecular weight of 495.19 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45481822 |
| Molecular Formula | C23H15Cl4NO3 |
| Molecular Weight | 495.19 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]isoindole-1,3-dione |
| SMILES | COc1ccc(CCc2ccc(N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)cc2)cc1 |
| InChI | InChI=1S/C23H15Cl4NO3/c1-31-15-10-6-13(7-11-15)3-2-12-4-8-14(9-5-12)28-22(29)16-17(23(28)30)19(25)21(27)20(26)18(16)24/h4-11H,2-3H2,1H3 |
| InChIKey | UQMCVDAPRKWQME-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.19 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|