C12H12N2O4S3 — CID 45481856
4-[(5E)-5-(ethoxymethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide (PubChem CID 45481856) has the molecular formula C12H12N2O4S3 and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-[(5E)-5-(ethoxymethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide.
| Compound Name | 4-[(5E)-5-(ethoxymethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 45481856 |
| Molecular Formula | C12H12N2O4S3 |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 4-[(5E)-5-(ethoxymethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide |
| SMILES | CCO/C=C1/SC(=S)N(c2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C12H12N2O4S3/c1-2-18-7-10-11(15)14(12(19)20-10)8-3-5-9(6-4-8)21(13,16)17/h3-7H,2H2,1H3,(H2,13,16,17)/b10-7+ |
| InChIKey | YSPCCYVOEJFBAR-JXMROGBWSA-N |
| XLogP | 1.58 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|