C16H15ClFN3O3 — CID 45481866
1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-methylurea (PubChem CID 45481866) has the molecular formula C16H15ClFN3O3 and a molecular weight of 351.77 g/mol. Its IUPAC name is 1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-methylurea.
| Compound Name | 1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-methylurea |
|---|---|
| PubChem CID | 45481866 |
| Molecular Formula | C16H15ClFN3O3 |
| Molecular Weight | 351.77 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C16H15ClFN3O3/c1-19-16(24)20-12-7-13(11(18)6-10(12)17)21-14(22)8-4-2-3-5-9(8)15(21)23/h6-7H,2-5H2,1H3,(H2,19,20,24) |
| InChIKey | KZLKGXVYAZMFKX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|