C22H16ClF4N3O3 — CID 45481869
1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 45481869) has the molecular formula C22H16ClF4N3O3 and a molecular weight of 481.83 g/mol. Its IUPAC name is 1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 45481869 |
| Molecular Formula | C22H16ClF4N3O3 |
| Molecular Weight | 481.83 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C22H16ClF4N3O3/c23-15-9-16(24)18(30-19(31)13-6-1-2-7-14(13)20(30)32)10-17(15)29-21(33)28-12-5-3-4-11(8-12)22(25,26)27/h3-5,8-10H,1-2,6-7H2,(H2,28,29,33) |
| InChIKey | DAOSRWDWMDTVAZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.83 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|