C21H16Cl2FN3O3 — CID 45481872
1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-(4-chlorophenyl)urea (PubChem CID 45481872) has the molecular formula C21H16Cl2FN3O3 and a molecular weight of 448.28 g/mol. Its IUPAC name is 1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 45481872 |
| Molecular Formula | C21H16Cl2FN3O3 |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 1-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-3-(4-chlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C21H16Cl2FN3O3/c22-11-5-7-12(8-6-11)25-21(30)26-17-10-18(16(24)9-15(17)23)27-19(28)13-3-1-2-4-14(13)20(27)29/h5-10H,1-4H2,(H2,25,26,30) |
| InChIKey | QVPOWHSESYDQJX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|