C22H18ClN3O4 — CID 45481943
N-[[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]carbamoyl]benzamide (PubChem CID 45481943) has the molecular formula C22H18ClN3O4 and a molecular weight of 423.86 g/mol. Its IUPAC name is N-[[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]carbamoyl]benzamide.
| Compound Name | N-[[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 45481943 |
| Molecular Formula | C22H18ClN3O4 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1)Nc1cc(N2C(=O)C3=C(CCCC3)C2=O)ccc1Cl |
| InChI | InChI=1S/C22H18ClN3O4/c23-17-11-10-14(26-20(28)15-8-4-5-9-16(15)21(26)29)12-18(17)24-22(30)25-19(27)13-6-2-1-3-7-13/h1-3,6-7,10-12H,4-5,8-9H2,(H2,24,25,27,30) |
| InChIKey | QWIRDKXGLCKBJA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|