C19H19Cl2FN2O3 — CID 45481946
3-chloro-N-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-2,2-dimethylpropanamide (PubChem CID 45481946) has the molecular formula C19H19Cl2FN2O3 and a molecular weight of 413.28 g/mol. Its IUPAC name is 3-chloro-N-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 45481946 |
| Molecular Formula | C19H19Cl2FN2O3 |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 3-chloro-N-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C19H19Cl2FN2O3/c1-19(2,9-20)18(27)23-14-8-15(13(22)7-12(14)21)24-16(25)10-5-3-4-6-11(10)17(24)26/h7-8H,3-6,9H2,1-2H3,(H,23,27) |
| InChIKey | CEOHODQTNGRZFA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|