C21H26ClN3O3 — CID 45481955
3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]-1,1-dipropylurea (PubChem CID 45481955) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]-1,1-dipropylurea.
| Compound Name | 3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 45481955 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1cc(N2C(=O)C3=C(CCCC3)C2=O)ccc1Cl |
| InChI | InChI=1S/C21H26ClN3O3/c1-3-11-24(12-4-2)21(28)23-18-13-14(9-10-17(18)22)25-19(26)15-7-5-6-8-16(15)20(25)27/h9-10,13H,3-8,11-12H2,1-2H3,(H,23,28) |
| InChIKey | JMXZYVMVPNAQRX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|