C21H21N7O2S — CID 45482068
N-[4-(furan-2-yl)-11-(3-methylbutyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-2-ylacetamide (PubChem CID 45482068) has the molecular formula C21H21N7O2S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-[4-(furan-2-yl)-11-(3-methylbutyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-(furan-2-yl)-11-(3-methylbutyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 45482068 |
| Molecular Formula | C21H21N7O2S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-[4-(furan-2-yl)-11-(3-methylbutyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-2-ylacetamide |
| SMILES | CC(C)CCn1cc2c(nc(NC(=O)Cc3cccs3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C21H21N7O2S/c1-13(2)7-8-27-12-15-18(25-27)24-21(22-17(29)11-14-5-4-10-31-14)28-20(15)23-19(26-28)16-6-3-9-30-16/h3-6,9-10,12-13H,7-8,11H2,1-2H3,(H,22,24,25,29) |
| InChIKey | VQTCVICDZZKIIH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |