C20H19N7O2S — CID 45482085
N-[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-2-ylacetamide (PubChem CID 45482085) has the molecular formula C20H19N7O2S and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 45482085 |
| Molecular Formula | C20H19N7O2S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-thiophen-2-ylacetamide |
| SMILES | CCCCn1cc2c(nc(NC(=O)Cc3cccs3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C20H19N7O2S/c1-2-3-8-26-12-14-17(24-26)23-20(21-16(28)11-13-6-5-10-30-13)27-19(14)22-18(25-27)15-7-4-9-29-15/h4-7,9-10,12H,2-3,8,11H2,1H3,(H,21,23,24,28) |
| InChIKey | RGMFJNIWCNZAIC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |