C30H34O7 — CID 45482095
[(3S,3aS,4R,5R,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methanol (PubChem CID 45482095) has the molecular formula C30H34O7 and a molecular weight of 506.60 g/mol. Its IUPAC name is [(3S,3aS,4R,5R,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methanol.
| Compound Name | [(3S,3aS,4R,5R,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methanol |
|---|---|
| PubChem CID | 45482095 |
| Molecular Formula | C30H34O7 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | [(3S,3aS,4R,5R,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methanol |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OCc2ccccc2)[C@@]2(OCc3ccccc3)[C@@H](OCc3ccccc3)CO[C@@H]12 |
| InChI | InChI=1S/C30H34O7/c1-32-29-28-30(36-20-24-15-9-4-10-16-24,26(21-35-28)33-18-22-11-5-2-6-12-22)27(25(17-31)37-29)34-19-23-13-7-3-8-14-23/h2-16,25-29,31H,17-21H2,1H3/t25-,26+,27-,28+,29+,30+/m1/s1 |
| InChIKey | KRNCSPAEWZMMNR-DYXWLRBRSA-N |
| XLogP | 3.88 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |